ChemNet > CAS > 305381-67-3 1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid
305381-67-3 1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid
| Nama produk |
1-methyl-1H-1,2,3-benzotriazole-5-carboxylic acid |
| Sinonim |
1-methyl-1H-benzotriazole-5-carboxylic acid |
| MF |
C8H7N3O2 |
| Berat Molekul |
177.1601 |
| InChI |
InChI=1/C8H7N3O2/c1-11-7-3-2-5(8(12)13)4-6(7)9-10-11/h2-4H,1H3,(H,12,13) |
| CAS NO |
305381-67-3 |
| Struktur Molekul |
|
| Kepadatan |
1.49g/cm3 |
| Titik lebur |
269℃ |
| Titik didih |
432.4°C at 760 mmHg |
| Indeks bias |
1.704 |
| Titik nyala |
215.3°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
